[(2S,3S,4R,5R,6S)-6-[3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate
| Internal ID | 43c9cf90-7507-4afd-b8e7-b2106067e478 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid C-glycosides |
| IUPAC Name | [(2S,3S,4R,5R,6S)-6-[3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)C2=C(C=C(C3=C2OC=C(C3=O)C4=CC(=C(C=C4)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC(=O)OC[C@H]1[C@H]([C@@H]([C@H]([C@@H](O1)C2=C(C=C(C3=C2OC=C(C3=O)C4=CC(=C(C=C4)O)O)O)O)O)O)O |
| InChI | InChI=1S/C23H22O12/c1-8(24)33-7-15-19(30)20(31)21(32)23(35-15)17-14(28)5-13(27)16-18(29)10(6-34-22(16)17)9-2-3-11(25)12(26)4-9/h2-6,15,19-21,23,25-28,30-32H,7H2,1H3/t15-,19+,20-,21+,23-/m0/s1 |
| InChI Key | PPCJHDPUVJLYLC-BIPHFIHCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H22O12 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.11112613 g/mol |
| Topological Polar Surface Area (TPSA) | 203.00 Ų |
| XlogP | -0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.98% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.92% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.98% | 83.82% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.39% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.96% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.51% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.41% | 99.15% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.92% | 83.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.51% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.02% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.38% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163082481 |
| LOTUS | LTS0101086 |
| wikiData | Q105212815 |