7,8-Dimethoxycoumarin
| Internal ID | be241b72-e8d4-4808-9875-d37a44533156 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7,8-dimethoxychromen-2-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)C=CC(=O)O2)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)C=CC(=O)O2)OC |
| InChI | InChI=1S/C11H10O4/c1-13-8-5-3-7-4-6-9(12)15-10(7)11(8)14-2/h3-6H,1-2H3 |
| InChI Key | CHBBSMUTOCUVDW-UHFFFAOYSA-N |
| Popularity | 16 references in papers |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 1.90 |
| 2445-80-9 |
| Daphnetin dimethyl ether |
| 7,8-dimethoxychromen-2-one |
| 2H-1-Benzopyran-2-one,7,8-dimethoxy- |
| 2H-1-Benzopyran-2-one, 7,8-dimethoxy- |
| Di-O-methyl-esculetin |
| 7,8-dimethoxy-coumarin |
| SCHEMBL3362753 |
| DTXSID70179212 |
| CHBBSMUTOCUVDW-UHFFFAOYSA-N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.32% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.43% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.30% | 90.20% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.19% | 99.23% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.35% | 94.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.83% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.80% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.55% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ayapana triplinervis |
| Citrus maxima |
| Citrus medica |
| Skimmia laureola |
| PubChem | 142768 |
| LOTUS | LTS0155268 |
| wikiData | Q72461386 |