7,8-Dimethoxy-4-methyldibenzofuran-1-carbaldehyde
| Internal ID | b90ee002-836f-400b-b2d1-01a9601aa77e |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 7,8-dimethoxy-4-methyldibenzofuran-1-carbaldehyde |
| SMILES (Canonical) | CC1=C2C(=C(C=C1)C=O)C3=CC(=C(C=C3O2)OC)OC |
| SMILES (Isomeric) | CC1=C2C(=C(C=C1)C=O)C3=CC(=C(C=C3O2)OC)OC |
| InChI | InChI=1S/C16H14O4/c1-9-4-5-10(8-17)15-11-6-13(18-2)14(19-3)7-12(11)20-16(9)15/h4-8H,1-3H3 |
| InChI Key | NOXBPEXNVDSCSI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 48.70 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.32% | 95.56% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 94.84% | 98.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.80% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.84% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.30% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.25% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.24% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.22% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.07% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.07% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.30% | 98.75% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.62% | 97.36% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.73% | 96.47% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.14% | 94.03% |
| CHEMBL3194 | P02766 | Transthyretin | 81.27% | 90.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.40% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ligularia nanchuanica |
| PubChem | 162989451 |
| LOTUS | LTS0165753 |
| wikiData | Q105182857 |