7,8-Dihydroxy-3-methyl-12-oxatetracyclo[8.3.0.01,3.04,8]tridec-9-en-13-one
| Internal ID | a78b33d7-c88a-4f05-9aed-6d73c173fed7 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 7,8-dihydroxy-3-methyl-12-oxatetracyclo[8.3.0.01,3.04,8]tridec-9-en-13-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H16O4/c1-11-6-12(11)7(5-17-10(12)15)4-13(16)8(11)2-3-9(13)14/h4,8-9,14,16H,2-3,5-6H2,1H3 |
| InChI Key | MFKNNUJZDWQTMD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
![2D Structure of 7,8-Dihydroxy-3-methyl-12-oxatetracyclo[8.3.0.01,3.04,8]tridec-9-en-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/78-dihydroxy-3-methyl-12-oxatetracyclo830013048tridec-9-en-13-one.jpg "2D Structure of 7,8-Dihydroxy-3-methyl-12-oxatetracyclo[8.3.0.01,3.04,8]tridec-9-en-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.27% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.78% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.43% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.10% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.10% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.09% | 96.09% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.98% | 92.88% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.89% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.48% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.26% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.97% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.35% | 95.89% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.28% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163065230 |
| LOTUS | LTS0212964 |
| wikiData | Q104171633 |