[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxymethyl]oxan-2-yl] 3,4,5-trihydroxybenzoate
Internal ID | 80e40b2e-3751-4942-89e3-a918bfe96c01 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxymethyl]oxan-2-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | CC(C)(C1CCC(=CC1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC(C)([C@@H]1CCC(=CC1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O |
InChI | InChI=1S/C23H30O12/c1-23(2,32)12-5-3-10(4-6-12)20(30)33-9-15-17(27)18(28)19(29)22(34-15)35-21(31)11-7-13(24)16(26)14(25)8-11/h3,7-8,12,15,17-19,22,24-29,32H,4-6,9H2,1-2H3/t12-,15+,17+,18-,19+,22-/m0/s1 |
InChI Key | GMBUWWLCKJYTTG-HAJNWZPMSA-N |
Popularity | 3 references in papers |
Molecular Formula | C23H30O12 |
Molecular Weight | 498.50 g/mol |
Exact Mass | 498.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | 0.00 |
241130-84-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.41% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.25% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.43% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.82% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.79% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.21% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.22% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.03% | 86.33% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.81% | 95.64% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.37% | 83.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.03% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.82% | 97.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.43% | 89.34% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.75% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.56% | 100.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.38% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.09% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.93% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.31% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.27% | 94.33% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 81.95% | 93.33% |
CHEMBL3194 | P02766 | Transthyretin | 81.57% | 90.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.72% | 95.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.32% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 101542613 |
LOTUS | LTS0186899 |
wikiData | Q105011631 |