[(1R,2R,3R,3aR,4S,5aR,6S,7S,8S,10aS,10bR)-4,7-diacetyloxy-3,6-di(butanoyloxy)-8-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate
| Internal ID | be70109e-8ef3-449e-a2ce-13e3908af7d5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Pentacarboxylic acids and derivatives |
| IUPAC Name | [(1R,2R,3R,3aR,4S,5aR,6S,7S,8S,10aS,10bR)-4,7-diacetyloxy-3,6-di(butanoyloxy)-8-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate |
| SMILES (Canonical) | CCCC(=O)OC1C(C2C3C=C(C(C(C(C3(CC(C2(C1OC(=O)CCC)C)OC(=O)C)C)OC(=O)CCC)OC(=O)C)O)C)C(C)C |
| SMILES (Isomeric) | CCCC(=O)O[C@@H]1[C@@H]([C@H]2[C@@H]3C=C([C@@H]([C@@H]([C@H]([C@@]3(C[C@@H]([C@@]2([C@H]1OC(=O)CCC)C)OC(=O)C)C)OC(=O)CCC)OC(=O)C)O)C)C(C)C |
| InChI | InChI=1S/C36H56O11/c1-11-14-25(39)45-31-28(19(4)5)29-23-17-20(6)30(42)32(44-22(8)38)33(46-26(40)15-12-2)35(23,9)18-24(43-21(7)37)36(29,10)34(31)47-27(41)16-13-3/h17,19,23-24,28-34,42H,11-16,18H2,1-10H3/t23-,24-,28+,29+,30-,31+,32-,33+,34-,35+,36-/m0/s1 |
| InChI Key | VPZWHHFNDPXINY-HIXNOTDZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H56O11 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.38226260 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | 5.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.12% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.66% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.17% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.23% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.14% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.04% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.03% | 85.14% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.81% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.21% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.11% | 97.79% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.22% | 92.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.70% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.30% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.99% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.44% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.67% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.84% | 92.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.26% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.70% | 99.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.43% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162944994 |
| LOTUS | LTS0046639 |
| wikiData | Q105291126 |