[(1S,2R,4R,8S,9R,10S,13S,16R)-8,16-dihydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidene-15-oxo-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate
| Internal ID | cf9daa25-1eb0-4adc-b03c-e9bf32657eb4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | [(1S,2R,4R,8S,9R,10S,13S,16R)-8,16-dihydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidene-15-oxo-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2C(CCC(C2(C3C14C(C(CC3)C(=C)C4=O)O)CO)O)(C)C |
| SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@H]2[C@]([C@H]3[C@]14[C@@H]([C@@H](CC3)C(=C)C4=O)O)([C@H](CCC2(C)C)O)CO |
| InChI | InChI=1S/C22H32O6/c1-11-13-5-6-14-21(10-23)15(20(3,4)8-7-16(21)25)9-17(28-12(2)24)22(14,18(11)26)19(13)27/h13-17,19,23,25,27H,1,5-10H2,2-4H3/t13-,14-,15+,16-,17+,19+,21-,22-/m0/s1 |
| InChI Key | PSIZCFTVSJGJTC-PUFYUQCQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21988874 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.24% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.00% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.09% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.56% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.96% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.90% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.05% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.93% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.86% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.70% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.28% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.99% | 96.77% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.94% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.87% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.38% | 91.07% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.46% | 96.61% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.05% | 97.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.97% | 92.94% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.85% | 95.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.37% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isodon umbrosus |
| PubChem | 163045846 |
| LOTUS | LTS0103241 |
| wikiData | Q105214199 |