[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 3ffd6234-2e97-4747-a68b-a6d8370b2779 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid 3p-O-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C30H26O14/c31-15-5-1-13(2-6-15)3-8-22(35)41-12-21-24(36)26(38)28(40)30(44-21)43-19-9-14(4-7-17(19)33)29-27(39)25(37)23-18(34)10-16(32)11-20(23)42-29/h1-11,21,24,26,28,30-34,36,38-40H,12H2/b8-3+/t21-,24-,26+,28-,30+/m1/s1 |
InChI Key | LUUMMUFQGCKXNB-LFMRSHHXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O14 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.13225550 g/mol |
Topological Polar Surface Area (TPSA) | 233.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.74% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 97.99% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.25% | 95.64% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.11% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.89% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.28% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 91.15% | 95.78% |
CHEMBL2581 | P07339 | Cathepsin D | 90.28% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.08% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.29% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.87% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.98% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.98% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.57% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.20% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.72% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.90% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.46% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.31% | 94.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.03% | 80.78% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.74% | 95.50% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.38% | 96.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.32% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rosa davurica |
PubChem | 163190422 |
LOTUS | LTS0088034 |
wikiData | Q105157661 |