[(1R,2R,11S,12S,19R,20S,39S)-7,8,12,13,13,25,26,27,30,31,32-undecahydroxy-4,14,17,22,35-pentaoxo-3,18,21,36,38,40-hexaoxaoctacyclo[18.17.1.12,19.19,12.05,10.011,16.023,28.029,34]tetraconta-5,7,9,15,23,25,27,29,31,33-decaen-39-yl] 3,4,5-trihydroxybenzoate
| Internal ID | 5952776e-1209-4109-96e0-acf762ca907d |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [(1R,2R,11S,12S,19R,20S,39S)-7,8,12,13,13,25,26,27,30,31,32-undecahydroxy-4,14,17,22,35-pentaoxo-3,18,21,36,38,40-hexaoxaoctacyclo[18.17.1.12,19.19,12.05,10.011,16.023,28.029,34]tetraconta-5,7,9,15,23,25,27,29,31,33-decaen-39-yl] 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=O)C(C7(C6C8=C(O7)C(=C(C=C8C(=O)O3)O)O)O)(O)O)OC(=O)C9=CC(=C(C(=C9)O)O)O |
| SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=O)C([C@@]7([C@H]6C8=C(O7)C(=C(C=C8C(=O)O3)O)O)O)(O)O)OC(=O)C9=CC(=C(C(=C9)O)O)O |
| InChI | InChI=1S/C41H28O27/c42-13-1-8(2-14(43)24(13)48)34(54)65-32-30-18-7-62-35(55)9-3-15(44)25(49)28(52)20(9)21-10(4-16(45)26(50)29(21)53)37(57)67-39(63-18)33(32)66-38(58)12-6-19(47)40(59,60)41(61)23(12)22-11(36(56)64-30)5-17(46)27(51)31(22)68-41/h1-6,18,23,30,32-33,39,42-46,48-53,59-61H,7H2/t18-,23-,30-,32+,33-,39+,41+/m1/s1 |
| InChI Key | WFWNGSCCGYXKPV-VIUILRJOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H28O27 |
| Molecular Weight | 952.60 g/mol |
| Exact Mass | 952.08179561 g/mol |
| Topological Polar Surface Area (TPSA) | 450.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.35% | 91.49% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.38% | 83.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.23% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.15% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.43% | 98.95% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.07% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.43% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.39% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.24% | 99.23% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.18% | 95.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.58% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.85% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.85% | 92.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.25% | 94.42% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.10% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia helioscopia |
| PubChem | 162880281 |
| LOTUS | LTS0191381 |
| wikiData | Q105304226 |