[(2R,3R)-3-(benzoyloxymethyl)-4-(4-hydroxy-3-methoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]butyl] benzoate
| Internal ID | 5093c334-8e3a-441a-9123-0df634db1012 |
| Taxonomy | Lignans, neolignans and related compounds > Dibenzylbutane lignans |
| IUPAC Name | [(2R,3R)-3-(benzoyloxymethyl)-4-(4-hydroxy-3-methoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]butyl] benzoate |
| SMILES (Canonical) | COC1=C(C=C(C=C1)CC(COC(=O)C2=CC=CC=C2)C(CC3=CC(=C(C=C3)O)OC)COC(=O)C4=CC=CC=C4)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C[C@@H](COC(=O)C2=CC=CC=C2)[C@@H](CC3=CC(=C(C=C3)O)OC)COC(=O)C4=CC=CC=C4)O |
| InChI | InChI=1S/C34H34O8/c1-39-31-16-14-23(19-30(31)36)17-27(21-41-33(37)25-9-5-3-6-10-25)28(18-24-13-15-29(35)32(20-24)40-2)22-42-34(38)26-11-7-4-8-12-26/h3-16,19-20,27-28,35-36H,17-18,21-22H2,1-2H3/t27-,28-/m0/s1 |
| InChI Key | XDDSQSSDBMRHJP-NSOVKSMOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H34O8 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 7.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.35% | 90.20% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.83% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.88% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.79% | 98.75% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.75% | 95.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.27% | 98.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.87% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.21% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.23% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.03% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.08% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.64% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.93% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.92% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163028188 |
| LOTUS | LTS0135870 |
| wikiData | Q105325650 |