(2S)-7-[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one
Internal ID | 858fc068-e752-4b63-bdac-76bf40e6cbb9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC=C(C=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C33H42O19/c1-11-22(38)25(41)28(44)31(46-11)52-30-27(43)24(40)20(10-35)51-33(30)48-14-6-15(36)21-16(37)8-17(49-18(21)7-14)12-2-4-13(5-3-12)47-32-29(45)26(42)23(39)19(9-34)50-32/h2-7,11,17,19-20,22-36,38-45H,8-10H2,1H3/t11-,17-,19+,20+,22-,23+,24+,25+,26-,27-,28+,29+,30+,31-,32+,33+/m0/s1 |
InChI Key | FHXACOPOJBXRQQ-NDKCODNESA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H42O19 |
Molecular Weight | 742.70 g/mol |
Exact Mass | 742.23202911 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -2.30 |
Naringin 4'-glucoside |
(2S)-7-[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-2-[4-(beta-D-glucopyranosyloxy)phenyl]-2,3-dihydro-5-hydroxy-, (2S)- |
Naringin 4'-beta-D-glucoside- |
DTXSID001311810 |
AKOS040762096 |
FS-8152 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.53% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.22% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.03% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.81% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.34% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.23% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.54% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.92% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.78% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.53% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.37% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.82% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.02% | 99.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.36% | 94.80% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.35% | 97.53% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.79% | 95.93% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.38% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.56% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus maxima |
PubChem | 101936129 |
LOTUS | LTS0243283 |
wikiData | Q104995490 |