3-[(3S,3aR,4R,5aR,6S,7S,9aR,9bR)-4-[(2R,3R,4S,5S)-3-acetyloxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-[(2S)-2-hydroxy-6-methyl-5-methylideneheptan-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid
| Internal ID | bb6c5b93-e898-40cd-9353-885de7286360 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
| IUPAC Name | 3-[(3S,3aR,4R,5aR,6S,7S,9aR,9bR)-4-[(2R,3R,4S,5S)-3-acetyloxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-[(2S)-2-hydroxy-6-methyl-5-methylideneheptan-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid |
| SMILES (Canonical) | CC(C)C(=C)CCC(C)(C1CCC2(C1C(CC3C2(CCC(C3(C)CCC(=O)O)C(=C)C)C)OC4C(C(C(O4)CO)O)OC(=O)C)C)O |
| SMILES (Isomeric) | CC(C)C(=C)CC[C@@](C)([C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(CC[C@H]([C@]3(C)CCC(=O)O)C(=C)C)C)O[C@H]4[C@@H]([C@H]([C@@H](O4)CO)O)OC(=O)C)C)O |
| InChI | InChI=1S/C38H62O9/c1-21(2)23(5)11-18-38(10,44)26-13-17-37(9)31(26)27(46-34-33(45-24(6)40)32(43)28(20-39)47-34)19-29-35(7,15-14-30(41)42)25(22(3)4)12-16-36(29,37)8/h21,25-29,31-34,39,43-44H,3,5,11-20H2,1-2,4,6-10H3,(H,41,42)/t25-,26-,27+,28-,29+,31-,32-,33+,34+,35-,36+,37+,38-/m0/s1 |
| InChI Key | DDJNYLNPKUVZPS-KRHVYRKASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H62O9 |
| Molecular Weight | 662.90 g/mol |
| Exact Mass | 662.43938355 g/mol |
| Topological Polar Surface Area (TPSA) | 143.00 Ų |
| XlogP | 7.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.39% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.42% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.67% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.06% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.88% | 97.79% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.11% | 96.61% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.10% | 92.50% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 87.93% | 94.97% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.64% | 94.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.62% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.52% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.50% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.32% | 86.33% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.75% | 97.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.00% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.20% | 91.19% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.96% | 91.07% |
| CHEMBL5028 | O14672 | ADAM10 | 83.95% | 97.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.46% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.31% | 94.08% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.08% | 82.50% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.07% | 97.86% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.61% | 100.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.51% | 94.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.17% | 85.14% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.09% | 97.14% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.50% | 98.10% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.07% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.05% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus serrulatoides |
| PubChem | 21596605 |
| LOTUS | LTS0078344 |
| wikiData | Q104976433 |