2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | e35dcff9-a7aa-479c-a5eb-862176ca9de2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-12-5-8(23)4-11-14(12)16(27)18(29)20(31-11)7-1-2-9(24)10(25)3-7/h1-5,13,15,17,19,21-26,28-30H,6H2 |
InChI Key | QJTYCCFDQWFJHU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O12 |
Molecular Weight | 464.40 g/mol |
Exact Mass | 464.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.55% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.80% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 94.33% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.32% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.56% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 92.49% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.98% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.92% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.73% | 86.33% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.22% | 95.64% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.07% | 95.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.76% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.41% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.49% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.63% | 90.71% |
CHEMBL2424 | Q04760 | Glyoxalase I | 82.16% | 91.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.42% | 97.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.73% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia capillaris |
Artemisia monosperma |
Lactuca indica |
Rhaponticum carthamoides subsp. carthamoides |
Styphnolobium japonicum |
PubChem | 22635124 |
LOTUS | LTS0261519 |
wikiData | Q105222877 |