[(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-8-heptyl-2-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate
| Internal ID | b797b600-189d-4c19-8fa7-5ce0ebf45964 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
| IUPAC Name | [(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-8-heptyl-2-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate |
| SMILES (Canonical) | CCCCCCCC1C(COC(=O)C(C(OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC(=O)C)O)OC(=O)C |
| SMILES (Isomeric) | CCCCCCC[C@@H]1[C@H](COC(=O)[C@H]([C@H](OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC(=O)C)O)OC(=O)C |
| InChI | InChI=1S/C26H36N2O9/c1-5-6-7-8-9-11-18-21(37-17(4)30)14-35-26(34)22(15(2)36-25(18)33)28-24(32)19-12-10-13-20(23(19)31)27-16(3)29/h10,12-13,15,18,21-22,31H,5-9,11,14H2,1-4H3,(H,27,29)(H,28,32)/t15-,18-,21+,22+/m1/s1 |
| InChI Key | MKJDAHGCQAVDPK-ALALXSPKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.24208073 g/mol |
| Topological Polar Surface Area (TPSA) | 157.00 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.22% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.43% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.01% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.94% | 94.73% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.57% | 89.63% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.94% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.40% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.28% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.66% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.08% | 94.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.73% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.58% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.31% | 96.77% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.06% | 86.33% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.66% | 93.04% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.36% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.33% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.10% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.29% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.10% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.07% | 93.56% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 80.30% | 85.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163111179 |
| LOTUS | LTS0136245 |
| wikiData | Q105166020 |