2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 9ed53e87-1da2-4d71-9b1f-d5ebb48b300a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C=C4C(=C3O)C(=O)C=C(O4)C5=CC(=C(C=C5)O)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C=C4C(=C3O)C(=O)C=C(O4)C5=CC(=C(C=C5)O)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O16/c1-9-19(32)22(35)24(37)27(41-9)40-8-17-20(33)23(36)25(38)28(43-17)44-26-16(39-2)7-15-18(21(26)34)13(31)6-14(42-15)10-3-4-11(29)12(30)5-10/h3-7,9,17,19-20,22-25,27-30,32-38H,8H2,1-2H3 |
InChI Key | MTUPEWBIUKFRBD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/75fa30c0-8604-11ee-a405-b3837fa77e42.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.87% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.32% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.00% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.73% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 96.12% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.13% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.63% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.58% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.69% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.21% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.09% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 86.76% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.32% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.23% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.36% | 86.92% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.35% | 94.03% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.40% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pterogyne nitens |
PubChem | 74343445 |
LOTUS | LTS0206762 |
wikiData | Q105171884 |