5-Hydroxy-6-methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 0970e1d5-cd33-4bbd-ba2d-79e68d3b481c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C29H34O15/c1-11-20(31)23(34)25(36)28(41-11)40-10-18-21(32)24(35)26(37)29(44-18)43-17-9-16-19(22(33)27(17)39-3)14(30)8-15(42-16)12-4-6-13(38-2)7-5-12/h4-9,11,18,20-21,23-26,28-29,31-37H,10H2,1-3H3 |
InChI Key | DUXQKCCELUKXOE-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H34O15 |
Molecular Weight | 622.60 g/mol |
Exact Mass | 622.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 223.00 Ų |
XlogP | -0.50 |
AKOS002137876 |
AKOS021617511 |
5-HYDROXY-6-METHOXY-2-(4-METHOXYPHENYL)-7-[(3,4,5-TRIHYDROXY-6-{[(3,4,5-TRIHYDROXY-6-METHYLOXAN-2-YL)OXY]METHYL}OXAN-2-YL)OXY]-4H-CHROMEN-4-ONE |
5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxymethyl]tetrahydropyran-2-yl]oxy-chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 98.13% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.10% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.31% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.96% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.58% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.12% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.73% | 99.15% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.22% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.94% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.55% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.46% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.03% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.94% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.77% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.02% | 97.09% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.80% | 81.11% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.80% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.83% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.69% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.29% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.16% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cirsium japonicum |
Cirsium setidens |
Cirsium subcoriaceum |
Kickxia elatine |
Linaria vulgaris |
Teucridium parvifolium |
PubChem | 3818047 |
LOTUS | LTS0068737 |
wikiData | Q104989623 |