methyl (4S,5E,6S)-5-ethylidene-4-[2-[[(1S,5S,6E,7S,14S,15S,16S,17R)-6-ethylidene-14,17-dimethyl-3,11-dioxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,8,12-trioxatricyclo[13.2.1.05,10]octadec-9-en-16-yl]methoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | a043bbc6-e7fb-43b7-af53-56acedb6179d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl (4S,5E,6S)-5-ethylidene-4-[2-[[(1S,5S,6E,7S,14S,15S,16S,17R)-6-ethylidene-14,17-dimethyl-3,11-dioxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,8,12-trioxatricyclo[13.2.1.05,10]octadec-9-en-16-yl]methoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C2CC(=O)OC3CC(C(COC(=O)C2=COC1OC4C(C(C(C(O4)CO)O)O)O)C)C(C3C)COC(=O)CC5C(=COC(C5=CC)OC6C(C(C(C(O6)CO)O)O)O)C(=O)OC |
SMILES (Isomeric) | C/C=C/1\[C@@H]2CC(=O)O[C@H]3C[C@@H]([C@@H](COC(=O)C2=CO[C@H]1O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C)[C@@H]([C@H]3C)COC(=O)C[C@@H]\5C(=CO[C@H](/C5=C/C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C(=O)OC |
InChI | InChI=1S/C43H60O22/c1-6-19-22(25(38(54)56-5)15-59-40(19)64-42-36(52)34(50)32(48)28(11-44)62-42)9-30(46)57-14-24-18(4)27-8-21(24)17(3)13-58-39(55)26-16-60-41(20(7-2)23(26)10-31(47)61-27)65-43-37(53)35(51)33(49)29(12-45)63-43/h6-7,15-18,21-24,27-29,32-37,40-45,48-53H,8-14H2,1-5H3/b19-6+,20-7+/t17-,18-,21+,22+,23+,24-,27+,28-,29-,32-,33-,34+,35+,36-,37-,40+,41+,42+,43+/m1/s1 |
InChI Key | QEHQBLYCUVJSGZ-QRCWDEGMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H60O22 |
Molecular Weight | 928.90 g/mol |
Exact Mass | 928.35762354 g/mol |
Topological Polar Surface Area (TPSA) | 322.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.26% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.64% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.41% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.33% | 97.79% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.94% | 94.80% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.66% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.41% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.01% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.38% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.51% | 86.92% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.39% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 87.13% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.70% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.29% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.61% | 92.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.57% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.52% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.96% | 90.17% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.31% | 98.03% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.11% | 89.34% |
CHEMBL5028 | O14672 | ADAM10 | 83.91% | 97.50% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.55% | 87.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.34% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.70% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.32% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum nudiflorum |
PubChem | 163028015 |
LOTUS | LTS0226563 |
wikiData | Q105219217 |