(3-Ethenyl-1,8-dihydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate
Internal ID | 0a1ec664-733a-462b-9df6-4d4dff9b2d95 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3-ethenyl-1,8-dihydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C(C2C1(C3C(CC(OC3(C(=O)C2)C)(C)C=C)O)C)(C)C)O |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C(C2C1(C3C(CC(OC3(C(=O)C2)C)(C)C=C)O)C)(C)C)O |
InChI | InChI=1S/C25H38O6/c1-9-14(3)21(29)30-19-12-17(27)22(4,5)16-11-18(28)25(8)20(24(16,19)7)15(26)13-23(6,10-2)31-25/h9-10,15-17,19-20,26-27H,2,11-13H2,1,3-8H3 |
InChI Key | AHELPUDACOAQRP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H38O6 |
Molecular Weight | 434.60 g/mol |
Exact Mass | 434.26683893 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.07% | 96.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.62% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.39% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.49% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.01% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.89% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.01% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.42% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.56% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.20% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.13% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.75% | 96.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.34% | 94.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.13% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum ambiguum |
PubChem | 163072485 |
LOTUS | LTS0221542 |
wikiData | Q104912207 |