(2R,3R,4R,5R,6S)-2-[[(3R,4R,5S)-3-hydroxy-5-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-3-yl]methoxy]-6-methyloxane-3,4,5-triol
| Internal ID | f88aa3c8-671d-4669-9cd1-cdc7f3827898 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-[[(3R,4R,5S)-3-hydroxy-5-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-3-yl]methoxy]-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(CO6)(COC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC19CCC(CO9)CO |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@](CO6)(CO[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O[C@]19CC[C@H](CO9)CO |
| InChI | InChI=1S/C44H70O16/c1-20-30-29(60-44(20)13-8-23(16-45)17-55-44)15-28-26-7-6-24-14-25(9-11-41(24,4)27(26)10-12-42(28,30)5)58-40-37(59-39-36(51)34(49)32(47)22(3)57-39)43(52,19-54-40)18-53-38-35(50)33(48)31(46)21(2)56-38/h6,20-23,25-40,45-52H,7-19H2,1-5H3/t20-,21-,22-,23-,25-,26+,27-,28-,29-,30-,31-,32-,33+,34+,35+,36+,37-,38+,39-,40-,41-,42-,43+,44+/m0/s1 |
| InChI Key | WJCRQBPWUMPGAL-KMHASORESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H70O16 |
| Molecular Weight | 855.00 g/mol |
| Exact Mass | 854.46638614 g/mol |
| Topological Polar Surface Area (TPSA) | 236.00 Ų |
| XlogP | 0.50 |
| RefChem:934451 |
| (2R,3R,4R,5R,6S)-2-(((3R,4R,5S)-3-hydroxy-5-((1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-5'-(hydroxymethyl)-7,9,13-trimethylspiro(5-oxapentacyclo(10.8.0.02,9.04,8.013,18)icos-18-ene-6,2'-oxane)-16-yl)oxy-4-((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxolan-3-yl)methoxy)-6-methyloxane-3,4,5-triol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.74% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.33% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.74% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.70% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.16% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.96% | 95.89% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.22% | 95.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.54% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.51% | 91.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.13% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.04% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.87% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.80% | 97.36% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.41% | 97.25% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.65% | 89.05% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.36% | 92.62% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.64% | 94.23% |
| CHEMBL5028 | O14672 | ADAM10 | 84.12% | 97.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.02% | 96.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.77% | 94.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.49% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.64% | 94.08% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.98% | 91.07% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.12% | 92.94% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.03% | 95.50% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.67% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44481516 |
| LOTUS | LTS0099601 |
| wikiData | Q105306687 |