[17-Acetyloxy-8-(furan-3-yl)-19-hydroxy-4-methoxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate
Internal ID | ef2c86fe-57a2-4105-b8fa-3fc089658cce |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [17-acetyloxy-8-(furan-3-yl)-19-hydroxy-4-methoxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate |
SMILES (Canonical) | CC1=C2C(CC1C3=COC=C3)OC(CC4C2(C(C5C6C4(C(CC(C6(CO5)C)OC(=O)C)O)C)OC(=O)C7=CC=CC=C7)C)OC |
SMILES (Isomeric) | CC1=C2C(CC1C3=COC=C3)OC(CC4C2(C(C5C6C4(C(CC(C6(CO5)C)OC(=O)C)O)C)OC(=O)C7=CC=CC=C7)C)OC |
InChI | InChI=1S/C36H44O9/c1-19-23(22-12-13-41-17-22)14-24-29(19)36(5)25(15-28(40-6)44-24)35(4)26(38)16-27(43-20(2)37)34(3)18-42-30(31(34)35)32(36)45-33(39)21-10-8-7-9-11-21/h7-13,17,23-28,30-32,38H,14-16,18H2,1-6H3 |
InChI Key | GVCKQCGCUAALBH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H44O9 |
Molecular Weight | 620.70 g/mol |
Exact Mass | 620.29853298 g/mol |
Topological Polar Surface Area (TPSA) | 114.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
![2D Structure of [17-Acetyloxy-8-(furan-3-yl)-19-hydroxy-4-methoxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate 2D Structure of [17-Acetyloxy-8-(furan-3-yl)-19-hydroxy-4-methoxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/74cd9d40-86b0-11ee-913e-7d3578d5e7cd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.97% | 90.17% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 98.32% | 81.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.31% | 86.33% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.64% | 87.67% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.55% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.22% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.94% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.08% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.26% | 97.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.48% | 83.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.08% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.07% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 86.50% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.18% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.69% | 94.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.96% | 97.53% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.68% | 89.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.33% | 93.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.57% | 92.98% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.98% | 90.24% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.15% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 85286138 |
LOTUS | LTS0131629 |
wikiData | Q105021044 |