2-[2-[6-[5,7-Dihydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one
| Internal ID | d64be002-c023-4a49-9ecf-54e3b0b6a3db |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 2-[2-[6-[5,7-dihydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C6=C(C(=O)C7=C(C=C(C=C7O6)O)O)OC8C(C(C(C(O8)C)O)O)O)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C6=C(C(=O)C7=C(C=C(C=C7O6)O)O)OC8C(C(C(C(O8)C)O)O)O)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C42H38O24/c1-9-25(49)33(57)35(59)41(61-9)65-39-31(55)23-15(45)3-11(43)5-19(23)63-37(39)13-7-17(47)27(51)29(53)21(13)22-14(8-18(48)28(52)30(22)54)38-40(66-42-36(60)34(58)26(50)10(2)62-42)32(56)24-16(46)4-12(44)6-20(24)64-38/h3-10,25-26,33-36,41-54,57-60H,1-2H3 |
| InChI Key | NERNVPVWYNAPQZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H38O24 |
| Molecular Weight | 926.70 g/mol |
| Exact Mass | 926.17530207 g/mol |
| Topological Polar Surface Area (TPSA) | 413.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of 2-[2-[6-[5,7-Dihydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/74c4e7c0-8744-11ee-be49-43b54c091f7b.jpg "2D Structure of 2-[2-[6-[5,7-Dihydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.93% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.87% | 89.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.48% | 95.64% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.12% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.94% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.57% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.27% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.89% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.61% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.71% | 99.17% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.43% | 94.42% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.15% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.61% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.09% | 99.23% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.90% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baeckea frutescens |
| PubChem | 163021292 |
| LOTUS | LTS0121432 |
| wikiData | Q105178137 |