(Z)-4-[(1S,2S,13S,15S)-7-[(2Z)-3,7-dimethylocta-2,6-dienyl]-6,8-dihydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enoic acid
Internal ID | 34272ede-07ec-443e-a922-3f89136d0f37 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | (Z)-4-[(1S,2S,13S,15S)-7-[(2Z)-3,7-dimethylocta-2,6-dienyl]-6,8-dihydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enoic acid |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=CC4CC5C3(O2)C(C4=O)(OC5(C)C)CC=C(C)C(=O)O)CC=C(C)C)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C\CC1=C(C(=C2C(=C1O)C(=O)C3=C[C@@H]4C[C@@H]5[C@@]3(O2)[C@@](C4=O)(OC5(C)C)C/C=C(/C)\C(=O)O)CC=C(C)C)O)/C)C |
InChI | InChI=1S/C38H46O8/c1-20(2)10-9-11-22(5)13-15-25-30(39)26(14-12-21(3)4)33-29(31(25)40)32(41)27-18-24-19-28-36(7,8)46-37(34(24)42,38(27,28)45-33)17-16-23(6)35(43)44/h10,12-13,16,18,24,28,39-40H,9,11,14-15,17,19H2,1-8H3,(H,43,44)/b22-13-,23-16-/t24-,28+,37-,38-/m1/s1 |
InChI Key | RCWNBHCZYXWDOV-ZLVWNHETSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H46O8 |
Molecular Weight | 630.80 g/mol |
Exact Mass | 630.31926842 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 7.90 |
There are no found synonyms. |
![2D Structure of (Z)-4-[(1S,2S,13S,15S)-7-[(2Z)-3,7-dimethylocta-2,6-dienyl]-6,8-dihydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enoic acid 2D Structure of (Z)-4-[(1S,2S,13S,15S)-7-[(2Z)-3,7-dimethylocta-2,6-dienyl]-6,8-dihydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/746413f0-855a-11ee-8743-055597f44e68.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.29% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.97% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.33% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.56% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.79% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.47% | 94.73% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.17% | 95.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.09% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.98% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.73% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.29% | 91.19% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.78% | 95.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.76% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.03% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.70% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcinia hanburyi |
PubChem | 163010472 |
LOTUS | LTS0089447 |
wikiData | Q105234022 |