[4-Acetyloxy-6-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] acetate
Internal ID | 8cf156f6-8c7d-4e8e-adf9-4490fbedec24 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [4-acetyloxy-6-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] acetate |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C)OC(=O)C)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)O |
SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C)OC(=O)C)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)O |
InChI | InChI=1S/C50H82O20/c1-22(10-11-31(56)46(6,7)62)33-25(54)17-48(9)30-16-27(67-43-38(61)36(59)35(58)28(18-51)68-43)41-45(4,5)32(12-13-50(41)21-49(30,50)15-14-47(33,48)8)69-44-40(70-42-37(60)34(57)26(55)19-63-42)39(66-24(3)53)29(20-64-44)65-23(2)52/h22,25-44,51,54-62H,10-21H2,1-9H3 |
InChI Key | PUHROWQRRBNZOO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H82O20 |
Molecular Weight | 1003.20 g/mol |
Exact Mass | 1002.53994500 g/mol |
Topological Polar Surface Area (TPSA) | 310.00 Ų |
XlogP | 1.10 |
Atomic LogP (AlogP) | 0.17 |
H-Bond Acceptor | 20 |
H-Bond Donor | 10 |
Rotatable Bonds | 14 |
There are no found synonyms. |
![2D Structure of [4-Acetyloxy-6-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] acetate 2D Structure of [4-Acetyloxy-6-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/74581c10-8606-11ee-a6a6-2dfa797869ab.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.5583 | 55.83% |
Caco-2 | - | 0.8806 | 88.06% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.7000 | 70.00% |
Subcellular localzation | Mitochondria | 0.7272 | 72.72% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8070 | 80.70% |
OATP1B3 inhibitior | + | 0.9129 | 91.29% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.6250 | 62.50% |
BSEP inhibitior | + | 0.8922 | 89.22% |
P-glycoprotein inhibitior | + | 0.7589 | 75.89% |
P-glycoprotein substrate | + | 0.6480 | 64.80% |
CYP3A4 substrate | + | 0.7452 | 74.52% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8804 | 88.04% |
CYP3A4 inhibition | - | 0.8492 | 84.92% |
CYP2C9 inhibition | - | 0.7876 | 78.76% |
CYP2C19 inhibition | - | 0.8640 | 86.40% |
CYP2D6 inhibition | - | 0.9553 | 95.53% |
CYP1A2 inhibition | - | 0.9034 | 90.34% |
CYP2C8 inhibition | + | 0.7071 | 70.71% |
CYP inhibitory promiscuity | - | 0.9765 | 97.65% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6966 | 69.66% |
Eye corrosion | - | 0.9897 | 98.97% |
Eye irritation | - | 0.9037 | 90.37% |
Skin irritation | - | 0.6943 | 69.43% |
Skin corrosion | - | 0.9413 | 94.13% |
Ames mutagenesis | - | 0.6048 | 60.48% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7477 | 74.77% |
Micronuclear | - | 0.7700 | 77.00% |
Hepatotoxicity | - | 0.6815 | 68.15% |
skin sensitisation | - | 0.9222 | 92.22% |
Respiratory toxicity | - | 0.5333 | 53.33% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.8777 | 87.77% |
Acute Oral Toxicity (c) | I | 0.5104 | 51.04% |
Estrogen receptor binding | + | 0.7977 | 79.77% |
Androgen receptor binding | + | 0.7398 | 73.98% |
Thyroid receptor binding | - | 0.5115 | 51.15% |
Glucocorticoid receptor binding | + | 0.7524 | 75.24% |
Aromatase binding | + | 0.6464 | 64.64% |
PPAR gamma | + | 0.8065 | 80.65% |
Honey bee toxicity | - | 0.5812 | 58.12% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
Fish aquatic toxicity | + | 0.8965 | 89.65% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.35% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.12% | 95.58% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.03% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.01% | 96.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 95.73% | 91.24% |
CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 92.93% | 92.88% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.37% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.90% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.15% | 96.77% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.71% | 98.75% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.83% | 82.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.39% | 85.14% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 88.70% | 95.69% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.70% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.47% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.36% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.10% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.87% | 91.07% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 87.85% | 99.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.50% | 97.79% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.24% | 97.29% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.14% | 96.61% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.07% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.72% | 98.10% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.15% | 95.71% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.89% | 95.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.62% | 94.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.05% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 84.80% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.71% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.60% | 94.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.14% | 89.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.03% | 95.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.93% | 95.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.31% | 92.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.22% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.12% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.48% | 97.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.43% | 96.95% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 82.12% | 92.86% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.78% | 96.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.68% | 90.24% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.61% | 91.03% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.46% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.39% | 92.86% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.30% | 93.18% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.06% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.94% | 94.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.92% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.51% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus icmadophilus |
PubChem | 162843936 |
LOTUS | LTS0115903 |
wikiData | Q105215100 |