1-(4,5-Dihydroxy-1,5-dimethylhexyl)-2,5-dihydroxy-3a,6,6,12a-tetramethyltetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-yl hexopyranoside
| Internal ID | a04dbfaa-f9d8-426e-ad2d-df6c844390f8 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | 2-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)O)O)O)C)C)O |
| SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)O)O)O)C)C)O |
| InChI | InChI=1S/C36H62O10/c1-18(8-9-23(40)32(4,5)44)25-20(39)15-34(7)22-14-19(38)29-31(2,3)24(46-30-28(43)27(42)26(41)21(16-37)45-30)10-11-36(29)17-35(22,36)13-12-33(25,34)6/h18-30,37-44H,8-17H2,1-7H3 |
| InChI Key | DAIWNSRTSAKURT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.43429817 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | 3.00 |
| 2-[(4,5-dihydroxy-1,5-dimethyl-hexyl)-dihydroxy-tetramethyl-[?]yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol |
![2D Structure of 1-(4,5-Dihydroxy-1,5-dimethylhexyl)-2,5-dihydroxy-3a,6,6,12a-tetramethyltetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-yl hexopyranoside](https://plantaedb.com/storage/docs/compounds/2023/11/74448440-8629-11ee-af7c-5528cd2eaa71.jpg "2D Structure of 1-(4,5-Dihydroxy-1,5-dimethylhexyl)-2,5-dihydroxy-3a,6,6,12a-tetramethyltetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-yl hexopyranoside")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.50% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.31% | 97.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.30% | 96.61% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.80% | 95.58% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 93.44% | 97.79% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 91.56% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 91.36% | 94.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.91% | 96.21% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.56% | 92.88% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.73% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.33% | 97.14% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.71% | 98.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.55% | 94.45% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.49% | 98.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.42% | 85.14% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.03% | 82.50% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 86.75% | 95.69% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.22% | 95.93% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.22% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.00% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.80% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.75% | 92.86% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 84.56% | 92.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.26% | 91.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.22% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.98% | 91.24% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 83.98% | 95.42% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 83.97% | 99.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.32% | 99.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.07% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.63% | 93.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.24% | 89.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.11% | 96.47% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.64% | 93.18% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.47% | 90.24% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.26% | 91.07% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.71% | 97.29% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.62% | 94.78% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.57% | 89.34% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.21% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus pycnocephalus |
| PubChem | 495619 |
| LOTUS | LTS0071394 |
| wikiData | Q104973633 |