4-oxo-4-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methoxy]butanoic acid
Internal ID | 43dcea91-3575-4185-9743-02ef1868d2e0 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-5-O-glycosides |
IUPAC Name | 4-oxo-4-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methoxy]butanoic acid |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C=C3C(=CC(=CC3=[O+]2)O)OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)COC(=O)CCC(=O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C=C3C(=CC(=CC3=[O+]2)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)COC(=O)CCC(=O)O)O)O)O)O |
InChI | InChI=1S/C31H34O18/c32-10-19-23(38)25(40)27(42)30(48-19)46-17-8-14(34)7-16-15(17)9-18(29(45-16)12-1-3-13(33)4-2-12)47-31-28(43)26(41)24(39)20(49-31)11-44-22(37)6-5-21(35)36/h1-4,7-9,19-20,23-28,30-32,38-43H,5-6,10-11H2,(H2-,33,34,35,36)/p+1/t19-,20+,23+,24+,25-,26-,27+,28+,30+,31+/m0/s1 |
InChI Key | WEDQIJAUFIWMNC-FYRDYRFTSA-O |
Popularity | 0 references in papers |
Molecular Formula | C31H35O18+ |
Molecular Weight | 695.60 g/mol |
Exact Mass | 695.18233926 g/mol |
Topological Polar Surface Area (TPSA) | 284.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of 4-oxo-4-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methoxy]butanoic acid 2D Structure of 4-oxo-4-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methoxy]butanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/741a9ed0-8752-11ee-8827-1bdfbaf32a13.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.55% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.52% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.71% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.36% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.70% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.44% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.57% | 95.78% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.34% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.31% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.36% | 86.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.89% | 91.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.62% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.57% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.54% | 83.82% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.19% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.12% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.83% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.78% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centaurea cyanus |
PubChem | 163191442 |
LOTUS | LTS0260034 |
wikiData | Q105302915 |