(1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione
| Internal ID | 325e8993-d72e-4ae9-b02d-14314b31b086 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione |
| SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C(=CCOC5=CC(=O)N4C6=C3C=CC=C6OC)C1 |
| SMILES (Isomeric) | CN1CC[C@]23[C@@H]4[C@H]5[C@@H](CC2=O)C(=CCOC5=CC(=O)N4C6=C3C=CC=C6OC)C1 |
| InChI | InChI=1S/C23H24N2O4/c1-24-8-7-23-15-4-3-5-16(28-2)21(15)25-19(27)11-17-20(22(23)25)14(10-18(23)26)13(12-24)6-9-29-17/h3-6,11,14,20,22H,7-10,12H2,1-2H3/t14-,20-,22-,23+/m0/s1 |
| InChI Key | BWCDHPDWBTWWLO-USDOHBJKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.17360725 g/mol |
| Topological Polar Surface Area (TPSA) | 59.10 Ų |
| XlogP | 0.40 |
| There are no found synonyms. |
![2D Structure of (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione](https://plantaedb.com/storage/docs/compounds/2023/11/73fb3c80-8592-11ee-b295-43cd16120bca.jpg "2D Structure of (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.84% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.68% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.14% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.59% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.55% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.64% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.94% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.10% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.84% | 95.89% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 87.03% | 96.39% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.28% | 100.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 86.12% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.39% | 90.71% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.21% | 90.95% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 82.04% | 98.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.86% | 92.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.60% | 93.99% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.53% | 96.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.50% | 82.69% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.03% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos icaja |
| PubChem | 162866786 |
| LOTUS | LTS0127210 |
| wikiData | Q104947105 |