2-[4-Hydroxy-6-[[8-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | a429a8fe-c608-42dd-ba1a-5dc12095f95c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-6-[[8-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC8C7(C(C(O8)(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC)C)O)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC8C7(C(C(O8)(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC)C)O)C)C)CO)O)O)O |
InChI | InChI=1S/C52H86O23/c1-21(20-67-45-39(61)38(60)35(57)30(18-53)71-45)10-15-51(66-7)24(4)52(65)32(75-51)17-29-27-9-8-25-16-26(11-13-49(25,5)28(27)12-14-50(29,52)6)70-48-44(74-47-41(63)37(59)34(56)23(3)69-47)42(64)43(31(19-54)72-48)73-46-40(62)36(58)33(55)22(2)68-46/h8,21-24,26-48,53-65H,9-20H2,1-7H3 |
InChI Key | CWIKVNQCUFTBDL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O23 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 355.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of 2-[4-Hydroxy-6-[[8-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4-Hydroxy-6-[[8-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/73ec1d40-8678-11ee-a145-396d7ce85d3b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.97% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.96% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.85% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.16% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.93% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.62% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.14% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.86% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.54% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.34% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.14% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.92% | 89.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.64% | 89.05% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.97% | 94.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.90% | 86.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.39% | 94.23% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 83.14% | 95.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.67% | 96.61% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.66% | 96.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.03% | 92.88% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.90% | 98.46% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.71% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.68% | 91.71% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.60% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.54% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.63% | 94.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.46% | 97.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.29% | 94.73% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.25% | 97.79% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.08% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycianthes synanthera |
Trillium erectum |
PubChem | 162889718 |
LOTUS | LTS0071315 |
wikiData | Q104971292 |