(5aR,10aS)-2-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one
Internal ID | 36728b51-953b-42bc-a6c6-2c0eaf80733d |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | (5aR,10aS)-2-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one |
SMILES (Canonical) | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C5=C(C=C4O)OC6(C7=C(C=C(C=C7)O)OC6(C5=O)O)CC=C(C)C)O |
SMILES (Isomeric) | CC1=C[C@H]([C@@H]([C@H](C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C5=C(C=C4O)O[C@@]6(C7=C(C=C(C=C7)O)O[C@@]6(C5=O)O)CC=C(C)C)O |
InChI | InChI=1S/C40H36O12/c1-18(2)10-11-39-27-9-6-22(43)16-31(27)52-40(39,50)38(49)35-32(51-39)17-30(46)34(37(35)48)26-13-19(3)12-25(23-7-4-20(41)14-28(23)44)33(26)36(47)24-8-5-21(42)15-29(24)45/h4-10,13-17,25-26,33,41-46,48,50H,11-12H2,1-3H3/t25-,26-,33-,39-,40-/m1/s1 |
InChI Key | XETHJOZXBVWLLM-JPNCQBQXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H36O12 |
Molecular Weight | 708.70 g/mol |
Exact Mass | 708.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 6.30 |
There are no found synonyms. |
![2D Structure of (5aR,10aS)-2-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one 2D Structure of (5aR,10aS)-2-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/73a36bb0-855b-11ee-b16c-139cda8fa7f3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 99.31% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.64% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.93% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.76% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.25% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.09% | 95.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.59% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.18% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.08% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.92% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.68% | 97.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 86.80% | 95.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.68% | 100.00% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.29% | 91.38% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.81% | 85.11% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.63% | 85.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.81% | 94.73% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.52% | 93.40% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.28% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.02% | 94.00% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.03% | 82.38% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.41% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.30% | 94.42% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.21% | 91.07% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.18% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Morus cathayana |
PubChem | 15479639 |
LOTUS | LTS0177117 |
wikiData | Q105326617 |