(1S,9R,16S,18R,21S)-6-[(15S,17S,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylic acid
Internal ID | 3c7fe429-3c9c-46ee-8250-19aab1173066 |
Taxonomy | Alkaloids and derivatives > Aspidofractine alkaloids |
IUPAC Name | (1S,9R,16S,18R,21S)-6-[(15S,17S,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylic acid |
SMILES (Canonical) | CCC12CCCN3C1C4=C(CC3)C5=CC=CC=C5N4C(C2)C6=CC7=C(C=C6)NC89C71CCN2C1C(CCC2)(CC8)CC9C(=O)O |
SMILES (Isomeric) | CC[C@@]12CCCN3[C@H]1C4=C(CC3)C5=CC=CC=C5N4[C@@H](C2)C6=CC7=C(C=C6)N[C@@]89[C@]71CCN2[C@H]1[C@@](CCC2)(CC8)C[C@H]9C(=O)O |
InChI | InChI=1S/C39H46N4O2/c1-2-36-12-5-17-41-19-11-26-25-7-3-4-8-30(25)43(32(26)33(36)41)31(23-36)24-9-10-29-27(21-24)38-16-20-42-18-6-13-37(35(38)42)14-15-39(38,40-29)28(22-37)34(44)45/h3-4,7-10,21,28,31,33,35,40H,2,5-6,11-20,22-23H2,1H3,(H,44,45)/t28-,31-,33-,35-,36-,37-,38+,39-/m0/s1 |
InChI Key | YKJPOSKZESOFGR-AQFJFXQZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H46N4O2 |
Molecular Weight | 602.80 g/mol |
Exact Mass | 602.36207672 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.47% | 95.56% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.58% | 95.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.98% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.38% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.28% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.17% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.16% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.43% | 97.09% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.90% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.87% | 91.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.37% | 89.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 87.90% | 98.59% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.38% | 99.23% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.70% | 92.98% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 84.18% | 95.62% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.89% | 90.95% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.97% | 96.39% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.60% | 92.62% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.85% | 95.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.75% | 94.45% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.63% | 97.50% |
CHEMBL5028 | O14672 | ADAM10 | 80.32% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia dasyrachis |
PubChem | 162992548 |
LOTUS | LTS0119038 |
wikiData | Q105349725 |