(2R,3S,3aR,5R)-2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3,4,5-tetrahydro-1-benzofuran-6-one
Internal ID | 7aaf61b3-fc20-4d23-966a-01e5e0f8020b |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | (2R,3S,3aR,5R)-2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3,4,5-tetrahydro-1-benzofuran-6-one |
SMILES (Canonical) | CC1C(OC2=CC(=O)C(CC12CC=C)OC)C3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | C[C@@H]1[C@@H](OC2=CC(=O)[C@@H](C[C@]12CC=C)OC)C3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C20H22O5/c1-4-7-20-10-17(22-3)14(21)9-18(20)25-19(12(20)2)13-5-6-15-16(8-13)24-11-23-15/h4-6,8-9,12,17,19H,1,7,10-11H2,2-3H3/t12-,17-,19-,20-/m1/s1 |
InChI Key | KVPKFECEKYTIPA-URGABHJQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O5 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of (2R,3S,3aR,5R)-2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3,4,5-tetrahydro-1-benzofuran-6-one 2D Structure of (2R,3S,3aR,5R)-2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3,4,5-tetrahydro-1-benzofuran-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/73582b50-8584-11ee-a1aa-8b4e40f6e4e3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 96.43% | 94.80% |
CHEMBL240 | Q12809 | HERG | 95.69% | 89.76% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.13% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.02% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.08% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.33% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.59% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.99% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.25% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.51% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.13% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.94% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.74% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.34% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.76% | 94.73% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.30% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.82% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.51% | 96.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.70% | 86.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.59% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.01% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Licaria armeniaca |
Ocotea porosa |
PubChem | 14132420 |
LOTUS | LTS0099170 |
wikiData | Q105146652 |