7,9,10-Trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-15-one
Internal ID | 2346c29b-e482-4777-8ef9-68c3d6cbb358 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | 7,9,10-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-15-one |
SMILES (Canonical) | CC1(C=CC(=O)C23C1C(C(C45C2CCC(C4)C(=C)C5O)(OC3)O)O)C |
SMILES (Isomeric) | CC1(C=CC(=O)C23C1C(C(C45C2CCC(C4)C(=C)C5O)(OC3)O)O)C |
InChI | InChI=1S/C20H26O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h6-7,11-12,14-16,22-24H,1,4-5,8-9H2,2-3H3 |
InChI Key | AYICIQWCTWRIFH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O5 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.62% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.07% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 90.12% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.05% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.87% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.33% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.15% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.41% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.27% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.75% | 97.14% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 84.40% | 80.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.10% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.88% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.62% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.41% | 90.17% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.32% | 96.43% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.46% | 94.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.96% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon eriocalyx |
PubChem | 14109074 |
LOTUS | LTS0211987 |
wikiData | Q104921121 |