(2S,3R,4S,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol
Internal ID | abd37bd7-749c-42a3-8807-fad8fc5c15c3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | (2S,3R,4S,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C(=C5)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C(=C5)O)O)O)O[C@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H40O21/c1-9-20(38)24(42)27(45)31(49-9)48-8-19-23(41)26(44)29(47)33(54-19)52-17-6-12-13(35)4-11(50-32-28(46)25(43)22(40)18(7-34)53-32)5-16(12)51-30(17)10-2-14(36)21(39)15(37)3-10/h2-6,9,18-20,22-29,31-34,38,40-47H,7-8H2,1H3,(H3-,35,36,37,39)/p+1/t9-,18+,19+,20-,22+,23+,24-,25-,26-,27+,28-,29+,31+,32+,33+/m0/s1 |
InChI Key | RNPFWTUNILZAAJ-JJVCRSRHSA-O |
Popularity | 0 references in papers |
Molecular Formula | C33H41O21+ |
Molecular Weight | 773.70 g/mol |
Exact Mass | 773.21403331 g/mol |
Topological Polar Surface Area (TPSA) | 340.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of (2S,3R,4S,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol 2D Structure of (2S,3R,4S,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/7305b1c0-8468-11ee-abc8-e13d17ed464a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.24% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.00% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.23% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.45% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.80% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.55% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.40% | 92.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.10% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 88.92% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.61% | 83.57% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.82% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.19% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.53% | 94.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.72% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.74% | 95.93% |
CHEMBL3194 | P02766 | Transthyretin | 82.27% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.61% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.14% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.14% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum carmichaelii var. truppelianum |
Campanula poscharskyana |
Delphinium schmalhausenii |
PubChem | 154496254 |
LOTUS | LTS0201342 |
wikiData | Q105241735 |