[(1R,2R,3R,4R,5S,7R,8S,9R,10R,11S,14R)-2,4,7,14-tetraacetyloxy-11-(2-acetyloxypropan-2-yl)-5,9-dimethyl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-8-yl] benzoate
| Internal ID | e95174ce-42c6-4925-86cc-83000e0b48f9 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
| IUPAC Name | [(1R,2R,3R,4R,5S,7R,8S,9R,10R,11S,14R)-2,4,7,14-tetraacetyloxy-11-(2-acetyloxypropan-2-yl)-5,9-dimethyl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-8-yl] benzoate |
| SMILES (Canonical) | CC1CC2(C(C1OC(=O)C)C(C34COC(C3C(C=CC4OC(=O)C)C(C)(C)OC(=O)C)(C2OC(=O)C5=CC=CC=C5)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@H]1C[C@]2([C@H]([C@@H]1OC(=O)C)[C@H]([C@@]34CO[C@]([C@@H]3[C@H](C=C[C@H]4OC(=O)C)C(C)(C)OC(=O)C)([C@@H]2OC(=O)C5=CC=CC=C5)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C37H46O13/c1-19-17-37(50-24(6)42)28(29(19)46-21(3)39)31(47-22(4)40)36-18-44-35(9,33(37)48-32(43)25-13-11-10-12-14-25)30(36)26(34(7,8)49-23(5)41)15-16-27(36)45-20(2)38/h10-16,19,26-31,33H,17-18H2,1-9H3/t19-,26-,27+,28+,29+,30-,31+,33-,35+,36+,37+/m0/s1 |
| InChI Key | FYMIXXOEKMFOIA-ZWBUUAICSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H46O13 |
| Molecular Weight | 698.80 g/mol |
| Exact Mass | 698.29384152 g/mol |
| Topological Polar Surface Area (TPSA) | 167.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.01% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.19% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.48% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.14% | 91.49% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.13% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.38% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.55% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.92% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 87.61% | 97.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.43% | 97.79% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.08% | 83.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.01% | 81.11% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.62% | 94.08% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.44% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.75% | 91.19% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.74% | 91.07% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.76% | 90.17% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.34% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia kopetdaghi |
| PubChem | 49845438 |
| LOTUS | LTS0069271 |
| wikiData | Q105004569 |