5-Methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 957782b0-86c0-4f79-abaa-01788f86a5c3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O14/c1-36-13-5-3-12(4-6-13)17-9-15(29)21-18(37-2)7-14(8-19(21)41-17)40-28-26(35)24(33)23(32)20(42-28)11-39-27-25(34)22(31)16(30)10-38-27/h3-9,16,20,22-28,30-35H,10-11H2,1-2H3 |
InChI Key | GGDFFHNOKNWBNL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O14 |
Molecular Weight | 592.50 g/mol |
Exact Mass | 592.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of 5-Methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 5-Methoxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/72d3bfe0-85f5-11ee-81d5-876dd088a24b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.83% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.63% | 94.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.56% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.20% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.85% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.41% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.00% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.86% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.31% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.06% | 86.92% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.62% | 93.31% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.57% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.00% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.98% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.13% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.78% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.41% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.84% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.67% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.33% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dirca palustris |
PubChem | 74977767 |
LOTUS | LTS0129202 |
wikiData | Q105007966 |