(2R,3Z,12bS)-2-[3-[(2R,3Z,12bS)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]cyclopentyl]-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine
Internal ID | 178de066-2235-4ded-8d1d-3a02f2bb2ad2 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
IUPAC Name | (2R,3Z,12bS)-2-[3-[(2R,3Z,12bS)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]cyclopentyl]-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine |
SMILES (Canonical) | CC=C1CN2CCC3=C(C2CC1C4CCC(C4)C5CC6C7=C(CCN6CC5=CC)C8=CC=CC=C8N7)NC9=CC=CC=C39 |
SMILES (Isomeric) | C/C=C\1/[C@H](C[C@@H]2N(C1)CCC3=C2NC4=CC=CC=C34)C5CC(CC5)[C@@H]6/C(=C/C)/CN7[C@@H](C6)C8=C(C9=CC=CC=C9N8)CC7 |
InChI | InChI=1S/C39H46N4/c1-3-24-22-42-17-15-30-28-9-5-7-11-34(28)40-38(30)36(42)20-32(24)26-13-14-27(19-26)33-21-37-39-31(16-18-43(37)23-25(33)4-2)29-10-6-8-12-35(29)41-39/h3-12,26-27,32-33,36-37,40-41H,13-23H2,1-2H3/b24-3+,25-4+/t26?,27?,32-,33-,36-,37-/m0/s1 |
InChI Key | DYCZKJGZLRZKDL-QRSVHGGBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H46N4 |
Molecular Weight | 570.80 g/mol |
Exact Mass | 570.37224748 g/mol |
Topological Polar Surface Area (TPSA) | 38.10 Ų |
XlogP | 7.00 |
There are no found synonyms. |
![2D Structure of (2R,3Z,12bS)-2-[3-[(2R,3Z,12bS)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]cyclopentyl]-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine 2D Structure of (2R,3Z,12bS)-2-[3-[(2R,3Z,12bS)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]cyclopentyl]-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine](https://plantaedb.com/storage/docs/compounds/2023/11/72d2abb0-85a1-11ee-a2aa-ffb2d2addce2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 96.89% | 89.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.61% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.61% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.52% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.74% | 97.09% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 90.74% | 90.71% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.52% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.04% | 91.11% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 88.22% | 96.42% |
CHEMBL228 | P31645 | Serotonin transporter | 88.09% | 95.51% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.81% | 92.98% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.71% | 88.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.27% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.18% | 95.83% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.83% | 95.00% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 83.24% | 97.15% |
CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 81.47% | 97.50% |
CHEMBL2535 | P11166 | Glucose transporter | 81.42% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.09% | 100.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.99% | 98.59% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.84% | 91.71% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.72% | 82.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.44% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.26% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos matopensis |
PubChem | 101208726 |
LOTUS | LTS0101725 |
wikiData | Q104991322 |