(5-Hydroxy-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,4a,5,7,8-octahydronaphthalen-2-yl) 4-hex-2-enoyloxyhex-2-enoate
Internal ID | 059a5659-d912-420b-a424-c1a8028fa918 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (5-hydroxy-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,4a,5,7,8-octahydronaphthalen-2-yl) 4-hex-2-enoyloxyhex-2-enoate |
SMILES (Canonical) | CCCC=CC(=O)OC(CC)C=CC(=O)OC1CCC2C(C(=O)C(CC2(C1C)C)C(=C)C)O |
SMILES (Isomeric) | CCCC=CC(=O)OC(CC)C=CC(=O)OC1CCC2C(C(=O)C(CC2(C1C)C)C(=C)C)O |
InChI | InChI=1S/C27H40O6/c1-7-9-10-11-23(28)32-19(8-2)12-15-24(29)33-22-14-13-21-26(31)25(30)20(17(3)4)16-27(21,6)18(22)5/h10-12,15,18-22,26,31H,3,7-9,13-14,16H2,1-2,4-6H3 |
InChI Key | YFGSWWXXMFQZNU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H40O6 |
Molecular Weight | 460.60 g/mol |
Exact Mass | 460.28248899 g/mol |
Topological Polar Surface Area (TPSA) | 89.90 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of (5-Hydroxy-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,4a,5,7,8-octahydronaphthalen-2-yl) 4-hex-2-enoyloxyhex-2-enoate 2D Structure of (5-Hydroxy-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,4a,5,7,8-octahydronaphthalen-2-yl) 4-hex-2-enoyloxyhex-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/722722a0-8550-11ee-a80b-5f6170b0cb28.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.99% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.83% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.47% | 91.19% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.10% | 96.38% |
CHEMBL2581 | P07339 | Cathepsin D | 91.22% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.33% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.88% | 90.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.50% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.53% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.98% | 86.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.02% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.44% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.11% | 97.09% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.79% | 100.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.35% | 95.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.32% | 91.07% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.90% | 92.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.69% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.26% | 95.93% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.03% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.44% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio erubescens |
PubChem | 162997006 |
LOTUS | LTS0105631 |
wikiData | Q105347581 |