15-Ethyl-1,2,6,6,10,18-hexamethyl-14,23-dioxahexacyclo[11.8.1.115,18.02,11.05,10.019,22]tricosan-7-ol
| Internal ID | a91e7750-8c2a-4a62-aa80-86f90ab79733 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 15-ethyl-1,2,6,6,10,18-hexamethyl-14,23-dioxahexacyclo[11.8.1.115,18.02,11.05,10.019,22]tricosan-7-ol |
| SMILES (Canonical) | CCC12CCC(O1)(C3CCC4(C3C(O2)CC5C4(CCC6C5(CCC(C6(C)C)O)C)C)C)C |
| SMILES (Isomeric) | CCC12CCC(O1)(C3CCC4(C3C(O2)CC5C4(CCC6C5(CCC(C6(C)C)O)C)C)C)C |
| InChI | InChI=1S/C29H48O3/c1-8-29-16-15-28(7,32-29)18-9-13-27(6)23(18)19(31-29)17-21-25(4)12-11-22(30)24(2,3)20(25)10-14-26(21,27)5/h18-23,30H,8-17H2,1-7H3 |
| InChI Key | ARYWBNCOXVUSSS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36034539 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 7.10 |
| There are no found synonyms. |
![2D Structure of 15-Ethyl-1,2,6,6,10,18-hexamethyl-14,23-dioxahexacyclo[11.8.1.115,18.02,11.05,10.019,22]tricosan-7-ol](https://plantaedb.com/storage/docs/compounds/2023/11/72209970-8611-11ee-b93a-8921e185e0c6.jpg "2D Structure of 15-Ethyl-1,2,6,6,10,18-hexamethyl-14,23-dioxahexacyclo[11.8.1.115,18.02,11.05,10.019,22]tricosan-7-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.51% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.08% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.97% | 82.69% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.89% | 97.79% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.78% | 95.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.65% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.14% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.06% | 90.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.14% | 95.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.84% | 95.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.91% | 96.43% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.01% | 92.98% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.99% | 89.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.51% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.50% | 92.94% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.10% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.34% | 95.89% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 81.33% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.59% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Panax ginseng |
| PubChem | 162873221 |
| LOTUS | LTS0085517 |
| wikiData | Q104917665 |