7,2'-Dihydroxy-6,4'-dimethoxyisoflavone
| Internal ID | e883575b-8580-4fe4-aa99-74752de37c8d |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 4-O-methylated isoflavonoids > 4-O-methylisoflavones |
| IUPAC Name | 7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C2=COC3=CC(=C(C=C3C2=O)OC)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C2=COC3=CC(=C(C=C3C2=O)OC)O)O |
| InChI | InChI=1S/C17H14O6/c1-21-9-3-4-10(13(18)5-9)12-8-23-15-7-14(19)16(22-2)6-11(15)17(12)20/h3-8,18-19H,1-2H3 |
| InChI Key | RHNVSRHYVGNPEO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.40 |
| 6,4'-Dimethoxy-7,2'-dihydroxyisoflavone |
| CHEMBL517700 |
| SCHEMBL1411063 |
| LMPK12050128 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.78% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.15% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.90% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.18% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.65% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.61% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.68% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.35% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.33% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.71% | 99.23% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.29% | 92.67% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.58% | 93.65% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.81% | 91.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.69% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycyrrhiza pallidiflora |
| Psorothamnus spinosus |
| PubChem | 44257255 |
| LOTUS | LTS0135546 |
| wikiData | Q105236553 |