[2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-[(Z)-2-methylbut-2-enoyl]oxypropyl] (Z)-2-methylbut-2-enoate
| Internal ID | bc92bc86-136f-4c22-97a8-a6b84a0385db |
| Taxonomy | Benzenoids > Phenols > Cresols > Meta cresols |
| IUPAC Name | [2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-[(Z)-2-methylbut-2-enoyl]oxypropyl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OCC(COC(=O)C(=CC)C)(C1=C(C=C(C=C1)C)O)O |
| SMILES (Isomeric) | C/C=C(\C(=O)OCC(O)(C1=C(C=C(C=C1)C)O)COC(=O)/C(=C\C)/C)/C |
| InChI | InChI=1S/C20H26O6/c1-6-14(4)18(22)25-11-20(24,12-26-19(23)15(5)7-2)16-9-8-13(3)10-17(16)21/h6-10,21,24H,11-12H2,1-5H3/b14-6-,15-7- |
| InChI Key | YOHOPTQLMXBXDB-LRSUZXNRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of [2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-[(Z)-2-methylbut-2-enoyl]oxypropyl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/71cc9350-8611-11ee-afcd-6b17504b4257.jpg "2D Structure of [2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-[(Z)-2-methylbut-2-enoyl]oxypropyl] (Z)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.26% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.87% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.66% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.17% | 97.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.90% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 87.14% | 89.76% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.12% | 96.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.31% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.96% | 86.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.47% | 85.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.75% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.49% | 99.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.92% | 89.62% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.07% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hofmeisteria schaffneri |
| PubChem | 101854609 |
| LOTUS | LTS0138750 |
| wikiData | Q103815811 |