7,19,23-Triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane
Internal ID | 7cb5852b-2b7b-4b9d-be85-84cba6c6cd72 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Aloperine and related alkaloids > Ormosia-type alkaloids |
IUPAC Name | 7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane |
SMILES (Canonical) | C1CCN2CC34CC(C2C1)CC5C3N(CCC5)C6CCCC4N6 |
SMILES (Isomeric) | C1CCN2CC34CC(C2C1)CC5C3N(CCC5)C6CCCC4N6 |
InChI | InChI=1S/C20H33N3/c1-2-9-22-13-20-12-15(16(22)6-1)11-14-5-4-10-23(19(14)20)18-8-3-7-17(20)21-18/h14-19,21H,1-13H2 |
InChI Key | MRLGBUWOAFGOBH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H33N3 |
Molecular Weight | 315.50 g/mol |
Exact Mass | 315.267448065 g/mol |
Topological Polar Surface Area (TPSA) | 18.50 Ų |
XlogP | 3.10 |
NSC133892 |
CHEMBL1991057 |
NSC-133892 |
NCI60_000748 |
![2D Structure of 7,19,23-Triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane 2D Structure of 7,19,23-Triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane](https://plantaedb.com/storage/docs/compounds/2023/11/71923-triazahexacyclo9911113126072101419tricosane.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.62% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.24% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 93.61% | 93.04% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 91.94% | 90.71% |
CHEMBL238 | Q01959 | Dopamine transporter | 91.60% | 95.88% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.52% | 94.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.41% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.37% | 96.09% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.97% | 99.18% |
CHEMBL228 | P31645 | Serotonin transporter | 87.63% | 95.51% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.55% | 95.50% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 86.90% | 97.98% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.05% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.51% | 93.40% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.42% | 93.03% |
CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 85.12% | 95.61% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 85.09% | 98.33% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.87% | 99.29% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.16% | 82.69% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.15% | 92.94% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.18% | 98.10% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 81.90% | 80.71% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.58% | 98.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.87% | 95.56% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.86% | 88.56% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.45% | 88.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ormosia amazonica |
PubChem | 281253 |
LOTUS | LTS0093179 |
wikiData | Q105170666 |