7,17-Diazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),3,5,11,13,15-hexaen-2-one
| Internal ID | f21a12d9-9bd3-41ae-be30-4d264c9765f9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | 7,17-diazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),3,5,11,13,15-hexaen-2-one |
| SMILES (Canonical) | C1CN2C=CC=C2C(=O)C3=C1C4=CC=CC=C4N3 |
| SMILES (Isomeric) | C1CN2C=CC=C2C(=O)C3=C1C4=CC=CC=C4N3 |
| InChI | InChI=1S/C15H12N2O/c18-15-13-6-3-8-17(13)9-7-11-10-4-1-2-5-12(10)16-14(11)15/h1-6,8,16H,7,9H2 |
| InChI Key | WRZHDHMHWJPGGV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.094963011 g/mol |
| Topological Polar Surface Area (TPSA) | 37.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 7,17-Diazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),3,5,11,13,15-hexaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/717-diazatetracyclo87003701116heptadeca-11035111315-hexaen-2-one.jpg "2D Structure of 7,17-Diazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),3,5,11,13,15-hexaen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 97.02% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.74% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.78% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.43% | 93.99% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.05% | 88.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.28% | 98.59% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.90% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.97% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.38% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.41% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.31% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.25% | 96.09% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.78% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.49% | 91.49% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.17% | 96.67% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.84% | 92.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.26% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus horridus |
| PubChem | 122206492 |
| LOTUS | LTS0182800 |
| wikiData | Q105311726 |