(2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-9-hydroxy-7,7,12,16-tetramethyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 7cd4e978-175d-4848-a974-a76f49af8334 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-9-hydroxy-7,7,12,16-tetramethyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC45CC46CCC7(C(C(CC7(C6CC(C5C3(C)C)O)C)OC8C(C(C(C(O8)CO)O)O)O)C(C)CCC(C(C)(C)O)O)C)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](CO[C@H]2O[C@H]3CC[C@]45C[C@]46CC[C@@]7([C@H]([C@H](C[C@]7([C@@H]6C[C@@H]([C@H]5C3(C)C)O)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)[C@H](C)CC[C@@H](C(C)(C)O)O)C)O)O)O)O)O |
InChI | InChI=1S/C47H80O18/c1-20(9-10-27(51)43(5,6)59)29-24(62-40-36(58)34(56)32(54)25(17-48)63-40)16-45(8)26-15-22(49)38-42(3,4)28(11-12-47(38)19-46(26,47)14-13-44(29,45)7)64-41-37(31(53)23(50)18-60-41)65-39-35(57)33(55)30(52)21(2)61-39/h20-41,48-59H,9-19H2,1-8H3/t20-,21+,22+,23-,24+,25-,26+,27+,28+,29+,30+,31+,32-,33-,34+,35-,36-,37-,38+,39+,40-,41+,44-,45+,46+,47-/m1/s1 |
InChI Key | MWNPPCNDDGPHRL-RMVFRIJVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H80O18 |
Molecular Weight | 933.10 g/mol |
Exact Mass | 932.53446570 g/mol |
Topological Polar Surface Area (TPSA) | 298.00 Ų |
XlogP | 0.40 |
Atomic LogP (AlogP) | -0.58 |
H-Bond Acceptor | 18 |
H-Bond Donor | 12 |
Rotatable Bonds | 12 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-9-hydroxy-7,7,12,16-tetramethyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-9-hydroxy-7,7,12,16-tetramethyl-14-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/71553e80-85ea-11ee-9442-15f1201e79f5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.4805 | 48.05% |
Caco-2 | - | 0.8837 | 88.37% |
Blood Brain Barrier | - | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.5846 | 58.46% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8219 | 82.19% |
OATP1B3 inhibitior | + | 0.9122 | 91.22% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.5750 | 57.50% |
BSEP inhibitior | - | 0.6078 | 60.78% |
P-glycoprotein inhibitior | + | 0.7503 | 75.03% |
P-glycoprotein substrate | + | 0.6395 | 63.95% |
CYP3A4 substrate | + | 0.7369 | 73.69% |
CYP2C9 substrate | - | 0.8018 | 80.18% |
CYP2D6 substrate | - | 0.8301 | 83.01% |
CYP3A4 inhibition | - | 0.9472 | 94.72% |
CYP2C9 inhibition | - | 0.7996 | 79.96% |
CYP2C19 inhibition | - | 0.8391 | 83.91% |
CYP2D6 inhibition | - | 0.9505 | 95.05% |
CYP1A2 inhibition | - | 0.8918 | 89.18% |
CYP2C8 inhibition | + | 0.6880 | 68.80% |
CYP inhibitory promiscuity | - | 0.9671 | 96.71% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6868 | 68.68% |
Eye corrosion | - | 0.9895 | 98.95% |
Eye irritation | - | 0.9048 | 90.48% |
Skin irritation | - | 0.7152 | 71.52% |
Skin corrosion | - | 0.9483 | 94.83% |
Ames mutagenesis | - | 0.6578 | 65.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7732 | 77.32% |
Micronuclear | - | 0.8000 | 80.00% |
Hepatotoxicity | - | 0.7122 | 71.22% |
skin sensitisation | - | 0.9113 | 91.13% |
Respiratory toxicity | + | 0.5111 | 51.11% |
Reproductive toxicity | + | 0.7444 | 74.44% |
Mitochondrial toxicity | - | 0.5875 | 58.75% |
Nephrotoxicity | - | 0.9349 | 93.49% |
Acute Oral Toxicity (c) | I | 0.6066 | 60.66% |
Estrogen receptor binding | + | 0.7450 | 74.50% |
Androgen receptor binding | + | 0.7447 | 74.47% |
Thyroid receptor binding | - | 0.5602 | 56.02% |
Glucocorticoid receptor binding | + | 0.6291 | 62.91% |
Aromatase binding | + | 0.6543 | 65.43% |
PPAR gamma | + | 0.7499 | 74.99% |
Honey bee toxicity | - | 0.5838 | 58.38% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
Fish aquatic toxicity | + | 0.8024 | 80.24% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.33% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 98.24% | 95.58% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.93% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.28% | 96.09% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.86% | 92.88% |
CHEMBL2581 | P07339 | Cathepsin D | 92.15% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.96% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.53% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.06% | 95.93% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.49% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.98% | 89.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.38% | 97.79% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 88.61% | 97.31% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.58% | 96.21% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.45% | 92.94% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 87.96% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.94% | 100.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 87.80% | 92.78% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.40% | 97.29% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.25% | 91.49% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 86.92% | 92.86% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.77% | 97.14% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.63% | 99.17% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 86.56% | 97.64% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.46% | 96.77% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.14% | 97.36% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.63% | 92.86% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.59% | 90.24% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.12% | 99.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 84.71% | 95.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.21% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.12% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.11% | 100.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.89% | 97.86% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.57% | 92.98% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 83.02% | 95.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.97% | 94.45% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.14% | 100.00% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.04% | 96.31% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.82% | 89.62% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.79% | 91.24% |
CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.76% | 98.57% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.30% | 95.83% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 81.01% | 95.42% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.83% | 95.38% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.67% | 90.08% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.65% | 89.50% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.40% | 93.18% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.00% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus prusianus |
Astragalus taschkendicus |
PubChem | 102008354 |
LOTUS | LTS0272231 |
wikiData | Q105173677 |