5,6-dihydroxy-4a-(hydroxymethyl)-1,1-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one
Internal ID | 22c4526b-3fce-44df-9f1e-ba580b8e1279 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 5,6-dihydroxy-4a-(hydroxymethyl)-1,1-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
SMILES (Canonical) | CC(C)C1=C(C(=C2C(=C1)C(=O)CC3C2(CCCC3(C)C)CO)O)O |
SMILES (Isomeric) | CC(C)C1=C(C(=C2C(=C1)C(=O)CC3C2(CCCC3(C)C)CO)O)O |
InChI | InChI=1S/C20H28O4/c1-11(2)12-8-13-14(22)9-15-19(3,4)6-5-7-20(15,10-21)16(13)18(24)17(12)23/h8,11,15,21,23-24H,5-7,9-10H2,1-4H3 |
InChI Key | PUXJVXOVZKVJTD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O4 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 3.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.34% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.93% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.19% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.86% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.22% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.02% | 99.15% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.78% | 94.75% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.40% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.38% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.97% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.67% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.57% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.41% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.28% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.07% | 89.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.97% | 93.04% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.97% | 96.21% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.61% | 93.31% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.02% | 93.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.94% | 85.14% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.90% | 85.11% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.53% | 91.07% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.39% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Plectranthus hadiensis |
PubChem | 163028848 |
LOTUS | LTS0065119 |
wikiData | Q105215337 |