7,14-Diazatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one
Internal ID | db143080-71ac-4395-af9f-80792febc5e2 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Leontidine-type alkaloids |
IUPAC Name | 7,14-diazatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one |
SMILES (Canonical) | C1CC2C3CC(CN2C(=O)C1)C4CCCN4C3 |
SMILES (Isomeric) | C1CC2C3CC(CN2C(=O)C1)C4CCCN4C3 |
InChI | InChI=1S/C14H22N2O/c17-14-5-1-3-13-10-7-11(9-16(13)14)12-4-2-6-15(12)8-10/h10-13H,1-9H2 |
InChI Key | ZALYGVJIPDSPLI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H22N2O |
Molecular Weight | 234.34 g/mol |
Exact Mass | 234.173213330 g/mol |
Topological Polar Surface Area (TPSA) | 23.60 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of 7,14-Diazatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one 2D Structure of 7,14-Diazatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/714-diazatetracyclo76102701014hexadecan-6-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.60% | 97.25% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.32% | 91.76% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.87% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.18% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.56% | 91.11% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 88.56% | 97.98% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 87.86% | 91.43% |
CHEMBL2581 | P07339 | Cathepsin D | 86.84% | 98.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 86.59% | 95.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.32% | 90.71% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.27% | 94.66% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.30% | 97.05% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.90% | 94.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.54% | 95.89% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.45% | 98.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.94% | 93.03% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.02% | 91.81% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.93% | 99.18% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.32% | 95.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.25% | 95.58% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.45% | 100.00% |
CHEMBL228 | P31645 | Serotonin transporter | 80.22% | 95.51% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.03% | 98.46% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camoensia scandens |
Maackia amurensis |
Sakoanala villosa |
PubChem | 163035900 |
LOTUS | LTS0190148 |
wikiData | Q104375614 |