[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxyoxan-2-yl]oxy-6-methyl-2-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-propyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] decanoate
Internal ID | f13cb137-3e26-41fd-a8e8-1ed5ec2462e2 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxyoxan-2-yl]oxy-6-methyl-2-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-propyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] decanoate |
SMILES (Canonical) | CCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2O)OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)C)O)O)CCC)C)C)OC5C(C(C(C(O5)C)OC(=O)C(C)CC)O)O)OC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | CCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2O)OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@H]([C@H](O4)C)O)O)CCC)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC(=O)[C@@H](C)CC)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
InChI | InChI=1S/C59H102O25/c1-9-12-13-14-16-20-24-28-38(62)79-53-52(84-56-44(68)41(65)40(64)36(29-60)77-56)49(82-55-45(69)43(67)47(32(6)73-55)80-54(71)30(4)11-3)34(8)75-59(53)81-48-33(7)74-58-51(46(48)70)78-37(61)27-23-21-18-15-17-19-22-26-35(25-10-2)76-57-50(83-58)42(66)39(63)31(5)72-57/h30-36,39-53,55-60,63-70H,9-29H2,1-8H3/t30-,31+,32-,33-,34-,35-,36+,39-,40+,41-,42-,43-,44+,45+,46+,47-,48-,49-,50+,51+,52+,53+,55-,56-,57-,58-,59-/m0/s1 |
InChI Key | VYTPDYPOQLIIJK-YEYNAETOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H102O25 |
Molecular Weight | 1211.40 g/mol |
Exact Mass | 1210.67101874 g/mol |
Topological Polar Surface Area (TPSA) | 353.00 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.31% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.11% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 97.04% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.41% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.87% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.76% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.04% | 93.56% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.84% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.34% | 97.25% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.76% | 97.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.55% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.71% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.64% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.42% | 96.61% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.90% | 97.36% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.53% | 92.62% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.22% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.13% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.42% | 90.71% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.73% | 98.10% |
CHEMBL299 | P17252 | Protein kinase C alpha | 85.67% | 98.03% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.50% | 97.29% |
CHEMBL4072 | P07858 | Cathepsin B | 85.34% | 93.67% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.34% | 96.38% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.04% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.51% | 92.86% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.13% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.72% | 83.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.71% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.48% | 91.19% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.29% | 82.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.06% | 94.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.17% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.93% | 99.23% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.69% | 92.32% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.67% | 94.66% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.61% | 96.37% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.55% | 93.04% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.35% | 90.08% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.28% | 98.46% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea quamoclit |
PubChem | 10464057 |
LOTUS | LTS0152252 |
wikiData | Q105299335 |