7,12,16-Trimethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol
| Internal ID | 5c08765e-bb87-4c36-bd70-e28e88512a5f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
| IUPAC Name | 7,12,16-trimethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| SMILES (Canonical) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1O)C)C(C)CCC=C(C)C)C |
| SMILES (Isomeric) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1O)C)C(C)CCC=C(C)C)C |
| InChI | InChI=1S/C29H48O/c1-19(2)8-7-9-20(3)22-12-14-27(6)25-11-10-23-21(4)24(30)13-15-28(23)18-29(25,28)17-16-26(22,27)5/h8,20-25,30H,7,9-18H2,1-6H3 |
| InChI Key | XZEUYTKSAYNYPK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.370516150 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 9.40 |
| There are no found synonyms. |
![2D Structure of 7,12,16-Trimethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/71216-trimethyl-15-6-methylhept-5-en-2-ylpentacyclo97001303801216octadecan-6-ol.jpg "2D Structure of 7,12,16-Trimethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.21% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.72% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.94% | 94.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 92.70% | 96.61% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.39% | 97.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.48% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.18% | 90.17% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 89.38% | 95.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.21% | 96.38% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.71% | 95.58% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.46% | 94.45% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.24% | 95.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.89% | 96.61% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.51% | 99.18% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.55% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.03% | 96.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.02% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.90% | 97.09% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 84.79% | 99.17% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.73% | 97.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.88% | 93.56% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.71% | 98.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.41% | 95.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.08% | 92.94% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.08% | 94.78% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.95% | 82.69% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.88% | 99.35% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.88% | 90.08% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.86% | 97.79% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.59% | 93.00% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.46% | 95.69% |
| CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 80.50% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.26% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia lucida |
| Xanthosoma robustum |
| PubChem | 14524545 |
| LOTUS | LTS0130250 |
| wikiData | Q105344882 |