(2S)-5-chloro-7-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-1,4-benzoxazin-3-one
| Internal ID | 3c57b1bd-7f74-46f8-bd09-cb40714a1460 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | (2S)-5-chloro-7-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-1,4-benzoxazin-3-one |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)Cl)NC(=O)C(O2)OC3C(C(C(C(O3)CO)O)O)O |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)Cl)NC(=O)[C@@H](O2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| InChI | InChI=1S/C15H18ClNO9/c1-23-5-2-6(16)9-7(3-5)24-15(13(22)17-9)26-14-12(21)11(20)10(19)8(4-18)25-14/h2-3,8,10-12,14-15,18-21H,4H2,1H3,(H,17,22)/t8-,10-,11+,12-,14+,15+/m1/s1 |
| InChI Key | KBVVPFFIPFKXPL-MHVRPGDESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H18ClNO9 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.0670088 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | -0.70 |
| Atomic LogP (AlogP) | -1.18 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 4 |
| There are no found synonyms. |
![2D Structure of (2S)-5-chloro-7-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-1,4-benzoxazin-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/70c5abf0-8671-11ee-bbe6-793413c578cd.jpg "2D Structure of (2S)-5-chloro-7-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-1,4-benzoxazin-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6300 | 63.00% |
| Caco-2 | - | 0.8565 | 85.65% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Nucleus | 0.3239 | 32.39% |
| OATP2B1 inhibitior | - | 0.8569 | 85.69% |
| OATP1B1 inhibitior | + | 0.8771 | 87.71% |
| OATP1B3 inhibitior | + | 0.9459 | 94.59% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | - | 0.5520 | 55.20% |
| P-glycoprotein inhibitior | - | 0.8482 | 84.82% |
| P-glycoprotein substrate | - | 0.8865 | 88.65% |
| CYP3A4 substrate | + | 0.6092 | 60.92% |
| CYP2C9 substrate | - | 0.7991 | 79.91% |
| CYP2D6 substrate | - | 0.8413 | 84.13% |
| CYP3A4 inhibition | - | 0.7677 | 76.77% |
| CYP2C9 inhibition | - | 0.7224 | 72.24% |
| CYP2C19 inhibition | - | 0.6318 | 63.18% |
| CYP2D6 inhibition | - | 0.8732 | 87.32% |
| CYP1A2 inhibition | - | 0.6887 | 68.87% |
| CYP2C8 inhibition | - | 0.7027 | 70.27% |
| CYP inhibitory promiscuity | - | 0.5561 | 55.61% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8038 | 80.38% |
| Carcinogenicity (trinary) | Non-required | 0.5095 | 50.95% |
| Eye corrosion | - | 0.9890 | 98.90% |
| Eye irritation | - | 0.9535 | 95.35% |
| Skin irritation | - | 0.8065 | 80.65% |
| Skin corrosion | - | 0.9461 | 94.61% |
| Ames mutagenesis | - | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4918 | 49.18% |
| Micronuclear | + | 0.7474 | 74.74% |
| Hepatotoxicity | - | 0.6978 | 69.78% |
| skin sensitisation | - | 0.8498 | 84.98% |
| Respiratory toxicity | + | 0.5333 | 53.33% |
| Reproductive toxicity | + | 0.8333 | 83.33% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.6280 | 62.80% |
| Acute Oral Toxicity (c) | III | 0.6886 | 68.86% |
| Estrogen receptor binding | + | 0.7070 | 70.70% |
| Androgen receptor binding | + | 0.6216 | 62.16% |
| Thyroid receptor binding | + | 0.5571 | 55.71% |
| Glucocorticoid receptor binding | + | 0.5445 | 54.45% |
| Aromatase binding | + | 0.5611 | 56.11% |
| PPAR gamma | + | 0.6938 | 69.38% |
| Honey bee toxicity | - | 0.8303 | 83.03% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5152 | 51.52% |
| Fish aquatic toxicity | - | 0.6117 | 61.17% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.93% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.54% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 96.31% | 86.92% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.73% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.44% | 85.14% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.29% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.11% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.04% | 90.00% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 87.51% | 97.78% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.13% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.59% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.40% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.67% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.30% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.35% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.22% | 95.89% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.09% | 94.80% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.99% | 96.21% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.10% | 92.62% |
| PubChem | 163022747 |
| LOTUS | LTS0139514 |
| wikiData | Q105138559 |