(5R,8R,9S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidenehept-1-en-2-yl)-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
| Internal ID | bbb1de62-4794-475c-b0c1-7e6e0f1717a0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (5R,8R,9S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidenehept-1-en-2-yl)-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES (Canonical) | CC(C)C(=C)CCC(=C)C1CCC2(C1(CCC3C2CCC4C3(CCC(=O)C4(C)C)C)C)C |
| SMILES (Isomeric) | CC(C)C(=C)CCC(=C)[C@H]1CC[C@]2([C@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@]3(CCC(=O)C4(C)C)C)C)C |
| InChI | InChI=1S/C31H50O/c1-20(2)21(3)10-11-22(4)23-14-18-31(9)25-12-13-26-28(5,6)27(32)16-17-29(26,7)24(25)15-19-30(23,31)8/h20,23-26H,3-4,10-19H2,1-2,5-9H3/t23-,24+,25-,26+,29+,30+,31-/m1/s1 |
| InChI Key | XFHJQPOEXGSDJI-HHGMXZGMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H50O |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.386166214 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 10.20 |
| There are no found synonyms. |
![2D Structure of (5R,8R,9S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidenehept-1-en-2-yl)-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/705f8610-85ae-11ee-9960-4df745ff44bf.jpg "2D Structure of (5R,8R,9S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidenehept-1-en-2-yl)-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.48% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.77% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.27% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.03% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.47% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.44% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.26% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.46% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.87% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.71% | 82.69% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.69% | 95.34% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.61% | 92.62% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.17% | 96.47% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.75% | 96.61% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.57% | 96.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.28% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bridelia balansae |
| PubChem | 163188520 |
| LOTUS | LTS0058022 |
| wikiData | Q105327036 |