[2-[3,5-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxy-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 3133cdf1-33a9-48f2-a011-67bc06fbdd3d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [2-[3,5-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxy-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)O)O |
InChI | InChI=1S/C30H26O12/c1-14-24(35)26(37)29(42-22(34)11-4-15-2-7-17(31)8-3-15)30(39-14)40-19-12-20(33)23-21(13-19)41-28(27(38)25(23)36)16-5-9-18(32)10-6-16/h2-14,24,26,29-33,35,37-38H,1H3 |
InChI Key | XUUODWXANHZAFB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O12 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.14242626 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.85% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.00% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.54% | 95.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.48% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 96.19% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.78% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.35% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.74% | 97.36% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.67% | 95.78% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 87.97% | 98.35% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.85% | 91.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.18% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.65% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.12% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.12% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.10% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.74% | 97.09% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 85.63% | 89.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.56% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.35% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.84% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.69% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.47% | 85.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.74% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.49% | 95.89% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.39% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetrapanax papyrifer |
PubChem | 73059213 |
LOTUS | LTS0099541 |
wikiData | Q105342600 |