(Z)-N-[(12S,18S,21R,30S)-18-(hydroxymethyl)-6,15,27-tris[3-[hydroxy(propanoyl)amino]propyl]-12-methyl-2,5,8,11,17,20,23,26,29-nonaoxo-21-propan-2-yl-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]dec-3-enamide
| Internal ID | 5e9c3f26-af59-43f5-9487-2e59c24f91dd |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (Z)-N-[(12S,18S,21R,30S)-18-(hydroxymethyl)-6,15,27-tris[3-[hydroxy(propanoyl)amino]propyl]-12-methyl-2,5,8,11,17,20,23,26,29-nonaoxo-21-propan-2-yl-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]dec-3-enamide |
| SMILES (Canonical) | CCCCCCC=CCC(=O)NC1COC(=O)CNC(=O)C(NC(=O)CNC(=O)C(NCC(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC1=O)CCCN(C(=O)CC)O)C(C)C)CO)CCCN(C(=O)CC)O)C)CCCN(C(=O)CC)O |
| SMILES (Isomeric) | CCCCCC/C=C\CC(=O)N[C@H]1COC(=O)CNC(=O)C(NC(=O)CNC(=O)[C@@H](NCC(NC(=O)[C@@H](NC(=O)[C@H](NC(=O)CNC(=O)C(NC1=O)CCCN(C(=O)CC)O)C(C)C)CO)CCCN(C(=O)CC)O)C)CCCN(C(=O)CC)O |
| InChI | InChI=1S/C54H93N13O18/c1-8-12-13-14-15-16-17-24-41(69)61-40-33-85-47(75)31-58-50(77)37(22-19-26-66(83)45(73)10-3)60-42(70)29-56-49(76)35(7)55-28-36(21-18-25-65(82)44(72)9-2)59-52(79)39(32-68)63-54(81)48(34(5)6)64-43(71)30-57-51(78)38(62-53(40)80)23-20-27-67(84)46(74)11-4/h16-17,34-40,48,55,68,82-84H,8-15,18-33H2,1-7H3,(H,56,76)(H,57,78)(H,58,77)(H,59,79)(H,60,70)(H,61,69)(H,62,80)(H,63,81)(H,64,71)/b17-16-/t35-,36?,37?,38?,39-,40-,48+/m0/s1 |
| InChI Key | DREINOTWQXJYOC-UQFGRUDZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H93N13O18 |
| Molecular Weight | 1212.40 g/mol |
| Exact Mass | 1211.67615317 g/mol |
| Topological Polar Surface Area (TPSA) | 442.00 Ų |
| XlogP | -0.40 |
| Atomic LogP (AlogP) | -2.43 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 25 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8585 | 85.85% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Mitochondria | 0.5230 | 52.30% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8004 | 80.04% |
| OATP1B3 inhibitior | + | 0.9207 | 92.07% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9386 | 93.86% |
| P-glycoprotein inhibitior | + | 0.7436 | 74.36% |
| P-glycoprotein substrate | + | 0.8471 | 84.71% |
| CYP3A4 substrate | + | 0.7199 | 71.99% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8307 | 83.07% |
| CYP3A4 inhibition | + | 0.5131 | 51.31% |
| CYP2C9 inhibition | - | 0.8341 | 83.41% |
| CYP2C19 inhibition | - | 0.8142 | 81.42% |
| CYP2D6 inhibition | - | 0.8985 | 89.85% |
| CYP1A2 inhibition | - | 0.8631 | 86.31% |
| CYP2C8 inhibition | + | 0.7377 | 73.77% |
| CYP inhibitory promiscuity | - | 0.9902 | 99.02% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.7000 | 70.00% |
| Carcinogenicity (trinary) | Non-required | 0.4635 | 46.35% |
| Eye corrosion | - | 0.9792 | 97.92% |
| Eye irritation | - | 0.8966 | 89.66% |
| Skin irritation | - | 0.7561 | 75.61% |
| Skin corrosion | - | 0.9220 | 92.20% |
| Ames mutagenesis | - | 0.5700 | 57.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6931 | 69.31% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.6603 | 66.03% |
| skin sensitisation | - | 0.8340 | 83.40% |
| Respiratory toxicity | + | 0.7111 | 71.11% |
| Reproductive toxicity | + | 0.7333 | 73.33% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | + | 0.6145 | 61.45% |
| Acute Oral Toxicity (c) | III | 0.6138 | 61.38% |
| Estrogen receptor binding | + | 0.7181 | 71.81% |
| Androgen receptor binding | + | 0.7015 | 70.15% |
| Thyroid receptor binding | + | 0.5272 | 52.72% |
| Glucocorticoid receptor binding | + | 0.6284 | 62.84% |
| Aromatase binding | + | 0.6906 | 69.06% |
| PPAR gamma | + | 0.7356 | 73.56% |
| Honey bee toxicity | - | 0.7082 | 70.82% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5930 | 59.30% |
| Fish aquatic toxicity | + | 0.8611 | 86.11% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.48% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.03% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.26% | 90.08% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.07% | 99.35% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.93% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.79% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.04% | 96.90% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.31% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.23% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.90% | 91.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.81% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.16% | 89.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.98% | 95.71% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.83% | 97.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.65% | 90.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.65% | 89.34% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.04% | 96.47% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.77% | 89.63% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.62% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.95% | 90.71% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.45% | 97.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.27% | 94.66% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.47% | 96.11% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.49% | 98.03% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.83% | 95.83% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.60% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.26% | 97.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.90% | 92.86% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.82% | 97.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.33% | 98.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.14% | 88.56% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 84.97% | 92.12% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.36% | 91.03% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 84.21% | 96.76% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.12% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.82% | 98.59% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.56% | 92.32% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.54% | 90.24% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.20% | 92.88% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.83% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.32% | 92.50% |
| CHEMBL1801 | P00747 | Plasminogen | 82.13% | 92.44% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 82.06% | 94.55% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.98% | 100.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 81.96% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.87% | 94.73% |
| CHEMBL1949 | P62937 | Cyclophilin A | 80.58% | 98.57% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.46% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.32% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163126964 |
| LOTUS | LTS0084564 |
| wikiData | Q104987354 |